C13H20N6O4S — CID 71206156
N-[6-(azidomethoxy)-3-pyridinyl]-5-(ethylsulfonylamino)pentanamide (PubChem CID 71206156) has the molecular formula C13H20N6O4S and a molecular weight of 356.41 g/mol. Its IUPAC name is N-[6-(azidomethoxy)-3-pyridinyl]-5-(ethylsulfonylamino)pentanamide.
| Compound Name | N-[6-(azidomethoxy)-3-pyridinyl]-5-(ethylsulfonylamino)pentanamide |
|---|---|
| PubChem CID | 71206156 |
| Molecular Formula | C13H20N6O4S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[6-(azidomethoxy)-3-pyridinyl]-5-(ethylsulfonylamino)pentanamide |
| SMILES | CCS(=O)(=O)NCCCCC(=O)Nc1ccc(OCN=[N+]=[N-])nc1 |
| InChI | InChI=1S/C13H20N6O4S/c1-2-24(21,22)17-8-4-3-5-12(20)18-11-6-7-13(15-9-11)23-10-16-19-14/h6-7,9,17H,2-5,8,10H2,1H3,(H,18,20) |
| InChIKey | BPNRSBXFQZEVJN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|