C17H18N2O5 — CID 39194137
4-[[6-(2-ethoxyphenoxy)-3-pyridinyl]amino]-4-oxobutanoic acid (PubChem CID 39194137) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is 4-[[6-(2-ethoxyphenoxy)-3-pyridinyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[6-(2-ethoxyphenoxy)-3-pyridinyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 39194137 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 4-[[6-(2-ethoxyphenoxy)-3-pyridinyl]amino]-4-oxobutanoic acid |
| SMILES | CCOc1ccccc1Oc1ccc(NC(=O)CCC(=O)O)cn1 |
| InChI | InChI=1S/C17H18N2O5/c1-2-23-13-5-3-4-6-14(13)24-16-9-7-12(11-18-16)19-15(20)8-10-17(21)22/h3-7,9,11H,2,8,10H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | JQUJJPDNPKWGII-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |