C17H17N3O5 — CID 39194101
4-[[6-(4-acetamidophenoxy)-3-pyridinyl]amino]-4-oxobutanoic acid (PubChem CID 39194101) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is 4-[[6-(4-acetamidophenoxy)-3-pyridinyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[6-(4-acetamidophenoxy)-3-pyridinyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 39194101 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-[[6-(4-acetamidophenoxy)-3-pyridinyl]amino]-4-oxobutanoic acid |
| SMILES | CC(=O)Nc1ccc(Oc2ccc(NC(=O)CCC(=O)O)cn2)cc1 |
| InChI | InChI=1S/C17H17N3O5/c1-11(21)19-12-2-5-14(6-3-12)25-16-8-4-13(10-18-16)20-15(22)7-9-17(23)24/h2-6,8,10H,7,9H2,1H3,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | TWABYWLCHMUQGT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |