C17H15F3N2O4 — CID 2814195
5-oxo-5-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]amino]pentanoic acid (PubChem CID 2814195) has the molecular formula C17H15F3N2O4 and a molecular weight of 368.31 g/mol. Its IUPAC name is 5-oxo-5-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]amino]pentanoic acid.
| Compound Name | 5-oxo-5-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 2814195 |
| Molecular Formula | C17H15F3N2O4 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 5-oxo-5-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]amino]pentanoic acid |
| SMILES | O=C(O)CCCC(=O)Nc1ccc(Oc2cccc(C(F)(F)F)c2)nc1 |
| InChI | InChI=1S/C17H15F3N2O4/c18-17(19,20)11-3-1-4-13(9-11)26-15-8-7-12(10-21-15)22-14(23)5-2-6-16(24)25/h1,3-4,7-10H,2,5-6H2,(H,22,23)(H,24,25) |
| InChIKey | XJGAERGPFUNACK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |