C16H12F3NO3 — CID 170873343
(E)-2-methyl-3-[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]prop-2-enoic acid (PubChem CID 170873343) has the molecular formula C16H12F3NO3 and a molecular weight of 323.27 g/mol. Its IUPAC name is (E)-2-methyl-3-[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-2-methyl-3-[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170873343 |
| Molecular Formula | C16H12F3NO3 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (E)-2-methyl-3-[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]prop-2-enoic acid |
| SMILES | C/C(=C\c1ccc(Oc2cccc(C(F)(F)F)c2)nc1)C(=O)O |
| InChI | InChI=1S/C16H12F3NO3/c1-10(15(21)22)7-11-5-6-14(20-9-11)23-13-4-2-3-12(8-13)16(17,18)19/h2-9H,1H3,(H,21,22)/b10-7+ |
| InChIKey | WVZMQSZZHYVBBN-JXMROGBWSA-N |
| XLogP | 4.38 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|