C15H12BrF3N2O2 — CID 7004327
(2R)-2-bromo-N-[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]propanamide (PubChem CID 7004327) has the molecular formula C15H12BrF3N2O2 and a molecular weight of 389.17 g/mol. Its IUPAC name is (2R)-2-bromo-N-[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]propanamide.
| Compound Name | (2R)-2-bromo-N-[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 7004327 |
| Molecular Formula | C15H12BrF3N2O2 |
| Molecular Weight | 389.17 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | (2R)-2-bromo-N-[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]propanamide |
| SMILES | C[C@@H](Br)C(=O)Nc1ccc(Oc2cccc(C(F)(F)F)c2)nc1 |
| InChI | InChI=1S/C15H12BrF3N2O2/c1-9(16)14(22)21-11-5-6-13(20-8-11)23-12-4-2-3-10(7-12)15(17,18)19/h2-9H,1H3,(H,21,22)/t9-/m1/s1 |
| InChIKey | FTKJLHZSLKRBKT-SECBINFHSA-N |
| XLogP | 4.61 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.17 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|