C17H18F3N3O2 — CID 119878544
2-methyl-3-(methylamino)-N-[6-[4-(trifluoromethyl)phenoxy]-3-pyridinyl]propanamide (PubChem CID 119878544) has the molecular formula C17H18F3N3O2 and a molecular weight of 353.34 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-N-[6-[4-(trifluoromethyl)phenoxy]-3-pyridinyl]propanamide.
| Compound Name | 2-methyl-3-(methylamino)-N-[6-[4-(trifluoromethyl)phenoxy]-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 119878544 |
| Molecular Formula | C17H18F3N3O2 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-methyl-3-(methylamino)-N-[6-[4-(trifluoromethyl)phenoxy]-3-pyridinyl]propanamide |
| SMILES | CNCC(C)C(=O)Nc1ccc(Oc2ccc(C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C17H18F3N3O2/c1-11(9-21-2)16(24)23-13-5-8-15(22-10-13)25-14-6-3-12(4-7-14)17(18,19)20/h3-8,10-11,21H,9H2,1-2H3,(H,23,24) |
| InChIKey | IKWJJGQZTRCIBU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |