C18H10F6N2O2 — CID 11516885
4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine (PubChem CID 11516885) has the molecular formula C18H10F6N2O2 and a molecular weight of 400.28 g/mol. Its IUPAC name is 4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine.
| Compound Name | 4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine |
|---|---|
| PubChem CID | 11516885 |
| Molecular Formula | C18H10F6N2O2 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine |
| SMILES | FC(F)(F)c1cccc(Oc2cc(Oc3cccc(C(F)(F)F)c3)ncn2)c1 |
| InChI | InChI=1S/C18H10F6N2O2/c19-17(20,21)11-3-1-5-13(7-11)27-15-9-16(26-10-25-15)28-14-6-2-4-12(8-14)18(22,23)24/h1-10H |
| InChIKey | CAHFMIUHKGJKLZ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |