C18H10F6N2O3 — CID 4035854
4,6-bis[3-(trifluoromethyl)phenoxy]-1H-pyrimidin-2-one (PubChem CID 4035854) has the molecular formula C18H10F6N2O3 and a molecular weight of 416.28 g/mol. Its IUPAC name is 4,6-bis[3-(trifluoromethyl)phenoxy]-1H-pyrimidin-2-one.
| Compound Name | 4,6-bis[3-(trifluoromethyl)phenoxy]-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 4035854 |
| Molecular Formula | C18H10F6N2O3 |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 4,6-bis[3-(trifluoromethyl)phenoxy]-1H-pyrimidin-2-one |
| SMILES | O=c1nc(Oc2cccc(C(F)(F)F)c2)cc(Oc2cccc(C(F)(F)F)c2)[nH]1 |
| InChI | InChI=1S/C18H10F6N2O3/c19-17(20,21)10-3-1-5-12(7-10)28-14-9-15(26-16(27)25-14)29-13-6-2-4-11(8-13)18(22,23)24/h1-9H,(H,25,26,27) |
| InChIKey | YMWAEUVISMTDQH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |