C17H13F6NO2 — CID 22572629
4-methyl-2-[(E)-4,4,4-trifluorobut-2-enoxy]-6-[3-(trifluoromethyl)phenoxy]pyridine (PubChem CID 22572629) has the molecular formula C17H13F6NO2 and a molecular weight of 377.28 g/mol. Its IUPAC name is 4-methyl-2-[(E)-4,4,4-trifluorobut-2-enoxy]-6-[3-(trifluoromethyl)phenoxy]pyridine.
| Compound Name | 4-methyl-2-[(E)-4,4,4-trifluorobut-2-enoxy]-6-[3-(trifluoromethyl)phenoxy]pyridine |
|---|---|
| PubChem CID | 22572629 |
| Molecular Formula | C17H13F6NO2 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 4-methyl-2-[(E)-4,4,4-trifluorobut-2-enoxy]-6-[3-(trifluoromethyl)phenoxy]pyridine |
| SMILES | Cc1cc(OC/C=C/C(F)(F)F)nc(Oc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H13F6NO2/c1-11-8-14(25-7-3-6-16(18,19)20)24-15(9-11)26-13-5-2-4-12(10-13)17(21,22)23/h2-6,8-10H,7H2,1H3/b6-3+ |
| InChIKey | BDIGTLFQNRTCCS-ZZXKWVIFSA-N |
| XLogP | 5.70 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|