C17H13F6NO2S — CID 91023650
4-methyl-2-[3-(trifluoromethyl)phenoxy]-6-[1-(trifluoromethylsulfanyl)prop-1-enoxy]pyridine (PubChem CID 91023650) has the molecular formula C17H13F6NO2S and a molecular weight of 409.35 g/mol. Its IUPAC name is 4-methyl-2-[3-(trifluoromethyl)phenoxy]-6-[1-(trifluoromethylsulfanyl)prop-1-enoxy]pyridine.
| Compound Name | 4-methyl-2-[3-(trifluoromethyl)phenoxy]-6-[1-(trifluoromethylsulfanyl)prop-1-enoxy]pyridine |
|---|---|
| PubChem CID | 91023650 |
| Molecular Formula | C17H13F6NO2S |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 4-methyl-2-[3-(trifluoromethyl)phenoxy]-6-[1-(trifluoromethylsulfanyl)prop-1-enoxy]pyridine |
| SMILES | CC=C(Oc1cc(C)cc(Oc2cccc(C(F)(F)F)c2)n1)SC(F)(F)F |
| InChI | InChI=1S/C17H13F6NO2S/c1-3-15(27-17(21,22)23)26-14-8-10(2)7-13(24-14)25-12-6-4-5-11(9-12)16(18,19)20/h3-9H,1-2H3 |
| InChIKey | KNWMMMUVHVIDMB-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|