C17H15F6NO3S — CID 91278381
4-methoxy-2-[3-(trifluoromethyl)phenoxy]-6-[1-(trifluoromethylsulfanyl)propoxy]pyridine (PubChem CID 91278381) has the molecular formula C17H15F6NO3S and a molecular weight of 427.37 g/mol. Its IUPAC name is 4-methoxy-2-[3-(trifluoromethyl)phenoxy]-6-[1-(trifluoromethylsulfanyl)propoxy]pyridine.
| Compound Name | 4-methoxy-2-[3-(trifluoromethyl)phenoxy]-6-[1-(trifluoromethylsulfanyl)propoxy]pyridine |
|---|---|
| PubChem CID | 91278381 |
| Molecular Formula | C17H15F6NO3S |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 4-methoxy-2-[3-(trifluoromethyl)phenoxy]-6-[1-(trifluoromethylsulfanyl)propoxy]pyridine |
| SMILES | CCC(Oc1cc(OC)cc(Oc2cccc(C(F)(F)F)c2)n1)SC(F)(F)F |
| InChI | InChI=1S/C17H15F6NO3S/c1-3-15(28-17(21,22)23)27-14-9-12(25-2)8-13(24-14)26-11-6-4-5-10(7-11)16(18,19)20/h4-9,15H,3H2,1-2H3 |
| InChIKey | LIVUWKWTMWXJLU-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|