C17H18N2O4 — CID 39194109
4-[[6-(3,5-dimethylphenoxy)-3-pyridinyl]amino]-4-oxobutanoic acid (PubChem CID 39194109) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 4-[[6-(3,5-dimethylphenoxy)-3-pyridinyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[6-(3,5-dimethylphenoxy)-3-pyridinyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 39194109 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-[[6-(3,5-dimethylphenoxy)-3-pyridinyl]amino]-4-oxobutanoic acid |
| SMILES | Cc1cc(C)cc(Oc2ccc(NC(=O)CCC(=O)O)cn2)c1 |
| InChI | InChI=1S/C17H18N2O4/c1-11-7-12(2)9-14(8-11)23-16-5-3-13(10-18-16)19-15(20)4-6-17(21)22/h3,5,7-10H,4,6H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | DSDTVLZNFHQMBX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |