C16H16F2N2O2 — CID 42691212
N-[6-(3,4-difluorophenoxy)-3-pyridinyl]-3-methylbutanamide (PubChem CID 42691212) has the molecular formula C16H16F2N2O2 and a molecular weight of 306.31 g/mol. Its IUPAC name is N-[6-(3,4-difluorophenoxy)-3-pyridinyl]-3-methylbutanamide.
| Compound Name | N-[6-(3,4-difluorophenoxy)-3-pyridinyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 42691212 |
| Molecular Formula | C16H16F2N2O2 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-[6-(3,4-difluorophenoxy)-3-pyridinyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(Oc2ccc(F)c(F)c2)nc1 |
| InChI | InChI=1S/C16H16F2N2O2/c1-10(2)7-15(21)20-11-3-6-16(19-9-11)22-12-4-5-13(17)14(18)8-12/h3-6,8-10H,7H2,1-2H3,(H,20,21) |
| InChIKey | BCOFCCZWMWPTQI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |