C16H21Cl2N3O3 — CID 119893847
3-amino-N-[6-(4-methoxyphenoxy)-3-pyridinyl]butanamide;dihydrochloride (PubChem CID 119893847) has the molecular formula C16H21Cl2N3O3 and a molecular weight of 374.27 g/mol. Its IUPAC name is 3-amino-N-[6-(4-methoxyphenoxy)-3-pyridinyl]butanamide;dihydrochloride.
| Compound Name | 3-amino-N-[6-(4-methoxyphenoxy)-3-pyridinyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119893847 |
| Molecular Formula | C16H21Cl2N3O3 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 3-amino-N-[6-(4-methoxyphenoxy)-3-pyridinyl]butanamide;dihydrochloride |
| SMILES | COc1ccc(Oc2ccc(NC(=O)CC(C)N)cn2)cc1.Cl.Cl |
| InChI | InChI=1S/C16H19N3O3.2ClH/c1-11(17)9-15(20)19-12-3-8-16(18-10-12)22-14-6-4-13(21-2)5-7-14;;/h3-8,10-11H,9,17H2,1-2H3,(H,19,20);2*1H |
| InChIKey | JIBIWZUXXONVER-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |