C18H25Cl2N3O3 — CID 119893859
(2S)-2-amino-N-[6-(4-methoxyphenoxy)-3-pyridinyl]-4-methylpentanamide;dihydrochloride (PubChem CID 119893859) has the molecular formula C18H25Cl2N3O3 and a molecular weight of 402.32 g/mol. Its IUPAC name is (2S)-2-amino-N-[6-(4-methoxyphenoxy)-3-pyridinyl]-4-methylpentanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-N-[6-(4-methoxyphenoxy)-3-pyridinyl]-4-methylpentanamide;dihydrochloride |
|---|---|
| PubChem CID | 119893859 |
| Molecular Formula | C18H25Cl2N3O3 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (2S)-2-amino-N-[6-(4-methoxyphenoxy)-3-pyridinyl]-4-methylpentanamide;dihydrochloride |
| SMILES | COc1ccc(Oc2ccc(NC(=O)[C@@H](N)CC(C)C)cn2)cc1.Cl.Cl |
| InChI | InChI=1S/C18H23N3O3.2ClH/c1-12(2)10-16(19)18(22)21-13-4-9-17(20-11-13)24-15-7-5-14(23-3)6-8-15;;/h4-9,11-12,16H,10,19H2,1-3H3,(H,21,22);2*1H/t16-;;/m0../s1 |
| InChIKey | RWNLDSYRWNZHPO-SQKCAUCHSA-N |
| XLogP | 4.04 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |