C17H19N3O5 — CID 110176757
ethyl N-[6-[4-(ethoxycarbonylamino)phenoxy]-3-pyridinyl]carbamate (PubChem CID 110176757) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is ethyl N-[6-[4-(ethoxycarbonylamino)phenoxy]-3-pyridinyl]carbamate.
| Compound Name | ethyl N-[6-[4-(ethoxycarbonylamino)phenoxy]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 110176757 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | ethyl N-[6-[4-(ethoxycarbonylamino)phenoxy]-3-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(Oc2ccc(NC(=O)OCC)cn2)cc1 |
| InChI | InChI=1S/C17H19N3O5/c1-3-23-16(21)19-12-5-8-14(9-6-12)25-15-10-7-13(11-18-15)20-17(22)24-4-2/h5-11H,3-4H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | AVBLQUCLLJDTIX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |