C16H19N3O4S — CID 8892342
N-(6-methoxy-3-pyridinyl)-3-[(4-methylphenyl)sulfonylamino]propanamide (PubChem CID 8892342) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is N-(6-methoxy-3-pyridinyl)-3-[(4-methylphenyl)sulfonylamino]propanamide.
| Compound Name | N-(6-methoxy-3-pyridinyl)-3-[(4-methylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 8892342 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-(6-methoxy-3-pyridinyl)-3-[(4-methylphenyl)sulfonylamino]propanamide |
| SMILES | COc1ccc(NC(=O)CCNS(=O)(=O)c2ccc(C)cc2)cn1 |
| InChI | InChI=1S/C16H19N3O4S/c1-12-3-6-14(7-4-12)24(21,22)18-10-9-15(20)19-13-5-8-16(23-2)17-11-13/h3-8,11,18H,9-10H2,1-2H3,(H,19,20) |
| InChIKey | QKIJWHHPUPOTQQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |