C15H14Cl2N2O4S — CID 110620787
3-(3,4-dichlorophenyl)sulfonyl-N-(6-methoxy-3-pyridinyl)propanamide (PubChem CID 110620787) has the molecular formula C15H14Cl2N2O4S and a molecular weight of 389.26 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)sulfonyl-N-(6-methoxy-3-pyridinyl)propanamide.
| Compound Name | 3-(3,4-dichlorophenyl)sulfonyl-N-(6-methoxy-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 110620787 |
| Molecular Formula | C15H14Cl2N2O4S |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 3-(3,4-dichlorophenyl)sulfonyl-N-(6-methoxy-3-pyridinyl)propanamide |
| SMILES | COc1ccc(NC(=O)CCS(=O)(=O)c2ccc(Cl)c(Cl)c2)cn1 |
| InChI | InChI=1S/C15H14Cl2N2O4S/c1-23-15-5-2-10(9-18-15)19-14(20)6-7-24(21,22)11-3-4-12(16)13(17)8-11/h2-5,8-9H,6-7H2,1H3,(H,19,20) |
| InChIKey | AOEJDQWTBRBKRF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |