C13H11Cl2N3O3S — CID 110673977
3-(3,4-dichlorophenyl)sulfonyl-N-pyrimidin-2-ylpropanamide (PubChem CID 110673977) has the molecular formula C13H11Cl2N3O3S and a molecular weight of 360.22 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)sulfonyl-N-pyrimidin-2-ylpropanamide.
| Compound Name | 3-(3,4-dichlorophenyl)sulfonyl-N-pyrimidin-2-ylpropanamide |
|---|---|
| PubChem CID | 110673977 |
| Molecular Formula | C13H11Cl2N3O3S |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 3-(3,4-dichlorophenyl)sulfonyl-N-pyrimidin-2-ylpropanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccc(Cl)c(Cl)c1)Nc1ncccn1 |
| InChI | InChI=1S/C13H11Cl2N3O3S/c14-10-3-2-9(8-11(10)15)22(20,21)7-4-12(19)18-13-16-5-1-6-17-13/h1-3,5-6,8H,4,7H2,(H,16,17,18,19) |
| InChIKey | SZTHJMPRUABKGW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |