C12H16F3N3O2 — CID 47002275
2,2,2-trifluoroethyl N-[6-(diethylamino)-3-pyridinyl]carbamate (PubChem CID 47002275) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[6-(diethylamino)-3-pyridinyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[6-(diethylamino)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 47002275 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[6-(diethylamino)-3-pyridinyl]carbamate |
| SMILES | CCN(CC)c1ccc(NC(=O)OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C12H16F3N3O2/c1-3-18(4-2)10-6-5-9(7-16-10)17-11(19)20-8-12(13,14)15/h5-7H,3-4,8H2,1-2H3,(H,17,19) |
| InChIKey | AJELHUYWTNVSIX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |