C13H17F3N2O2 — CID 63180338
2,2,2-trifluoroethyl N-[4-(diethylamino)phenyl]carbamate (PubChem CID 63180338) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.29 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[4-(diethylamino)phenyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[4-(diethylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 63180338 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[4-(diethylamino)phenyl]carbamate |
| SMILES | CCN(CC)c1ccc(NC(=O)OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3N2O2/c1-3-18(4-2)11-7-5-10(6-8-11)17-12(19)20-9-13(14,15)16/h5-8H,3-4,9H2,1-2H3,(H,17,19) |
| InChIKey | GKTRFZFNCVXVSJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|