C17H29N3O — CID 65265051
3-amino-N-[4-(diethylamino)phenyl]-2,2,3-trimethylbutanamide (PubChem CID 65265051) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 3-amino-N-[4-(diethylamino)phenyl]-2,2,3-trimethylbutanamide.
| Compound Name | 3-amino-N-[4-(diethylamino)phenyl]-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 65265051 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 3-amino-N-[4-(diethylamino)phenyl]-2,2,3-trimethylbutanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(C)(C)C(C)(C)N)cc1 |
| InChI | InChI=1S/C17H29N3O/c1-7-20(8-2)14-11-9-13(10-12-14)19-15(21)16(3,4)17(5,6)18/h9-12H,7-8,18H2,1-6H3,(H,19,21) |
| InChIKey | ZYLJQQIDQXMGOW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|