C23H31N3O2 — CID 108968103
N-[4-(diethylamino)phenyl]-N'-(2,6-dimethylphenyl)-2,2-dimethylpropanediamide (PubChem CID 108968103) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-N'-(2,6-dimethylphenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-[4-(diethylamino)phenyl]-N'-(2,6-dimethylphenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108968103 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-N'-(2,6-dimethylphenyl)-2,2-dimethylpropanediamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(C)(C)C(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C23H31N3O2/c1-7-26(8-2)19-14-12-18(13-15-19)24-21(27)23(5,6)22(28)25-20-16(3)10-9-11-17(20)4/h9-15H,7-8H2,1-6H3,(H,24,27)(H,25,28) |
| InChIKey | JKHUMDALUJUVPR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|