C12H14F3NO4 — CID 65173487
2,2,2-trifluoroethyl N-(4-ethoxy-3-methoxyphenyl)carbamate (PubChem CID 65173487) has the molecular formula C12H14F3NO4 and a molecular weight of 293.24 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-(4-ethoxy-3-methoxyphenyl)carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-(4-ethoxy-3-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 65173487 |
| Molecular Formula | C12H14F3NO4 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2,2,2-trifluoroethyl N-(4-ethoxy-3-methoxyphenyl)carbamate |
| SMILES | CCOc1ccc(NC(=O)OCC(F)(F)F)cc1OC |
| InChI | InChI=1S/C12H14F3NO4/c1-3-19-9-5-4-8(6-10(9)18-2)16-11(17)20-7-12(13,14)15/h4-6H,3,7H2,1-2H3,(H,16,17) |
| InChIKey | UQMXETKZWUCPRN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |