C10H12FNO3 — CID 114840894
ethyl N-(4-fluoro-3-methoxyphenyl)carbamate (PubChem CID 114840894) has the molecular formula C10H12FNO3 and a molecular weight of 213.21 g/mol. Its IUPAC name is ethyl N-(4-fluoro-3-methoxyphenyl)carbamate.
| Compound Name | ethyl N-(4-fluoro-3-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 114840894 |
| Molecular Formula | C10H12FNO3 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | ethyl N-(4-fluoro-3-methoxyphenyl)carbamate |
| SMILES | CCOC(=O)Nc1ccc(F)c(OC)c1 |
| InChI | InChI=1S/C10H12FNO3/c1-3-15-10(13)12-7-4-5-8(11)9(6-7)14-2/h4-6H,3H2,1-2H3,(H,12,13) |
| InChIKey | IMNZBQKRSATQAD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |