C11H12F3NO4S — CID 65173666
2,2,2-trifluoroethyl N-(4-ethylsulfonylphenyl)carbamate (PubChem CID 65173666) has the molecular formula C11H12F3NO4S and a molecular weight of 311.28 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-(4-ethylsulfonylphenyl)carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-(4-ethylsulfonylphenyl)carbamate |
|---|---|
| PubChem CID | 65173666 |
| Molecular Formula | C11H12F3NO4S |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 2,2,2-trifluoroethyl N-(4-ethylsulfonylphenyl)carbamate |
| SMILES | CCS(=O)(=O)c1ccc(NC(=O)OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12F3NO4S/c1-2-20(17,18)9-5-3-8(4-6-9)15-10(16)19-7-11(12,13)14/h3-6H,2,7H2,1H3,(H,15,16) |
| InChIKey | FCNCKEUGELIEKW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |