C15H13F3N2O3S — CID 33174489
N-(4-ethylsulfonylphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 33174489) has the molecular formula C15H13F3N2O3S and a molecular weight of 358.34 g/mol. Its IUPAC name is N-(4-ethylsulfonylphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(4-ethylsulfonylphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 33174489 |
| Molecular Formula | C15H13F3N2O3S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-(4-ethylsulfonylphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(NC(=O)c2ccc(C(F)(F)F)nc2)cc1 |
| InChI | InChI=1S/C15H13F3N2O3S/c1-2-24(22,23)12-6-4-11(5-7-12)20-14(21)10-3-8-13(19-9-10)15(16,17)18/h3-9H,2H2,1H3,(H,20,21) |
| InChIKey | TYOSWXCPFSOWGS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |