C14H10F3N3O2 — CID 167658935
N-(5-acetyl-2-pyridinyl)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 167658935) has the molecular formula C14H10F3N3O2 and a molecular weight of 309.25 g/mol. Its IUPAC name is N-(5-acetyl-2-pyridinyl)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(5-acetyl-2-pyridinyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167658935 |
| Molecular Formula | C14H10F3N3O2 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-(5-acetyl-2-pyridinyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2ccc(C(F)(F)F)nc2)nc1 |
| InChI | InChI=1S/C14H10F3N3O2/c1-8(21)9-3-5-12(19-6-9)20-13(22)10-2-4-11(18-7-10)14(15,16)17/h2-7H,1H3,(H,19,20,22) |
| InChIKey | VYEYVLJBBAYPIH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |