C15H11F3N2O2 — CID 84591908
N-(5-acetyl-2-pyridinyl)-2-(trifluoromethyl)benzamide (PubChem CID 84591908) has the molecular formula C15H11F3N2O2 and a molecular weight of 308.26 g/mol. Its IUPAC name is N-(5-acetyl-2-pyridinyl)-2-(trifluoromethyl)benzamide.
| Compound Name | N-(5-acetyl-2-pyridinyl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 84591908 |
| Molecular Formula | C15H11F3N2O2 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-(5-acetyl-2-pyridinyl)-2-(trifluoromethyl)benzamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2ccccc2C(F)(F)F)nc1 |
| InChI | InChI=1S/C15H11F3N2O2/c1-9(21)10-6-7-13(19-8-10)20-14(22)11-4-2-3-5-12(11)15(16,17)18/h2-8H,1H3,(H,19,20,22) |
| InChIKey | DZARSJGLVKICQH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |