C18H12F3N3O — CID 71848765
N-(2-phenylpyrimidin-4-yl)-2-(trifluoromethyl)benzamide (PubChem CID 71848765) has the molecular formula C18H12F3N3O and a molecular weight of 343.31 g/mol. Its IUPAC name is N-(2-phenylpyrimidin-4-yl)-2-(trifluoromethyl)benzamide.
| Compound Name | N-(2-phenylpyrimidin-4-yl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 71848765 |
| Molecular Formula | C18H12F3N3O |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-(2-phenylpyrimidin-4-yl)-2-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccnc(-c2ccccc2)n1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H12F3N3O/c19-18(20,21)14-9-5-4-8-13(14)17(25)24-15-10-11-22-16(23-15)12-6-2-1-3-7-12/h1-11H,(H,22,23,24,25) |
| InChIKey | HHVAMSFGRUXEGA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |