C14H7ClF4N2O2 — CID 22099637
6-[[4-fluoro-2-(trifluoromethyl)benzoyl]amino]pyridine-3-carbonyl chloride (PubChem CID 22099637) has the molecular formula C14H7ClF4N2O2 and a molecular weight of 346.67 g/mol. Its IUPAC name is 6-[[4-fluoro-2-(trifluoromethyl)benzoyl]amino]pyridine-3-carbonyl chloride.
| Compound Name | 6-[[4-fluoro-2-(trifluoromethyl)benzoyl]amino]pyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 22099637 |
| Molecular Formula | C14H7ClF4N2O2 |
| Molecular Weight | 346.67 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 6-[[4-fluoro-2-(trifluoromethyl)benzoyl]amino]pyridine-3-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc(NC(=O)c2ccc(F)cc2C(F)(F)F)nc1 |
| InChI | InChI=1S/C14H7ClF4N2O2/c15-12(22)7-1-4-11(20-6-7)21-13(23)9-3-2-8(16)5-10(9)14(17,18)19/h1-6H,(H,20,21,23) |
| InChIKey | DWWQAWLKWZKGGE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|