C14H8F4N2O3 — CID 22099714
6-[[4-fluoro-2-(trifluoromethyl)benzoyl]amino]pyridine-3-carboxylic acid (PubChem CID 22099714) has the molecular formula C14H8F4N2O3 and a molecular weight of 328.22 g/mol. Its IUPAC name is 6-[[4-fluoro-2-(trifluoromethyl)benzoyl]amino]pyridine-3-carboxylic acid.
| Compound Name | 6-[[4-fluoro-2-(trifluoromethyl)benzoyl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 22099714 |
| Molecular Formula | C14H8F4N2O3 |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 6-[[4-fluoro-2-(trifluoromethyl)benzoyl]amino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2ccc(F)cc2C(F)(F)F)nc1 |
| InChI | InChI=1S/C14H8F4N2O3/c15-8-2-3-9(10(5-8)14(16,17)18)12(21)20-11-4-1-7(6-19-11)13(22)23/h1-6H,(H,22,23)(H,19,20,21) |
| InChIKey | HBBYLFZQPBBPFY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |