C10H10F3NO5S — CID 3391907
2,2,2-trifluoroethyl 4-(methoxycarbonylamino)benzenesulfonate (PubChem CID 3391907) has the molecular formula C10H10F3NO5S and a molecular weight of 313.25 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-(methoxycarbonylamino)benzenesulfonate.
| Compound Name | 2,2,2-trifluoroethyl 4-(methoxycarbonylamino)benzenesulfonate |
|---|---|
| PubChem CID | 3391907 |
| Molecular Formula | C10H10F3NO5S |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-(methoxycarbonylamino)benzenesulfonate |
| SMILES | COC(=O)Nc1ccc(S(=O)(=O)OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F3NO5S/c1-18-9(15)14-7-2-4-8(5-3-7)20(16,17)19-6-10(11,12)13/h2-5H,6H2,1H3,(H,14,15) |
| InChIKey | AMDYTSUJXJLEKS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|