C15H10F6N2O5S2 — CID 19433219
1,3-bis[4-(trifluoromethylsulfonyl)phenyl]urea (PubChem CID 19433219) has the molecular formula C15H10F6N2O5S2 and a molecular weight of 476.38 g/mol. Its IUPAC name is 1,3-bis[4-(trifluoromethylsulfonyl)phenyl]urea.
| Compound Name | 1,3-bis[4-(trifluoromethylsulfonyl)phenyl]urea |
|---|---|
| PubChem CID | 19433219 |
| Molecular Formula | C15H10F6N2O5S2 |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | 1,3-bis[4-(trifluoromethylsulfonyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(S(=O)(=O)C(F)(F)F)cc1)Nc1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10F6N2O5S2/c16-14(17,18)29(25,26)11-5-1-9(2-6-11)22-13(24)23-10-3-7-12(8-4-10)30(27,28)15(19,20)21/h1-8H,(H2,22,23,24) |
| InChIKey | JQPHRESYNNWBIF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |