C16H12F3NO4S — CID 46568918
N-(4-acetylphenyl)-4-(trifluoromethylsulfonyl)benzamide (PubChem CID 46568918) has the molecular formula C16H12F3NO4S and a molecular weight of 371.34 g/mol. Its IUPAC name is N-(4-acetylphenyl)-4-(trifluoromethylsulfonyl)benzamide.
| Compound Name | N-(4-acetylphenyl)-4-(trifluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 46568918 |
| Molecular Formula | C16H12F3NO4S |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | N-(4-acetylphenyl)-4-(trifluoromethylsulfonyl)benzamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2ccc(S(=O)(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H12F3NO4S/c1-10(21)11-2-6-13(7-3-11)20-15(22)12-4-8-14(9-5-12)25(23,24)16(17,18)19/h2-9H,1H3,(H,20,22) |
| InChIKey | CEIGQQUOWQPADB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |