C16H12ClF3N2O4S — CID 55916990
N-(5-acetamido-2-chlorophenyl)-4-(trifluoromethylsulfonyl)benzamide (PubChem CID 55916990) has the molecular formula C16H12ClF3N2O4S and a molecular weight of 420.80 g/mol. Its IUPAC name is N-(5-acetamido-2-chlorophenyl)-4-(trifluoromethylsulfonyl)benzamide.
| Compound Name | N-(5-acetamido-2-chlorophenyl)-4-(trifluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 55916990 |
| Molecular Formula | C16H12ClF3N2O4S |
| Molecular Weight | 420.80 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | N-(5-acetamido-2-chlorophenyl)-4-(trifluoromethylsulfonyl)benzamide |
| SMILES | CC(=O)Nc1ccc(Cl)c(NC(=O)c2ccc(S(=O)(=O)C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C16H12ClF3N2O4S/c1-9(23)21-11-4-7-13(17)14(8-11)22-15(24)10-2-5-12(6-3-10)27(25,26)16(18,19)20/h2-8H,1H3,(H,21,23)(H,22,24) |
| InChIKey | GTDFLPIRCVZBJN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.80 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |