C19H22ClN3O4S — CID 55917241
N-(5-acetamido-2-chlorophenyl)-3-(dimethylsulfamoyl)-4,5-dimethylbenzamide (PubChem CID 55917241) has the molecular formula C19H22ClN3O4S and a molecular weight of 423.92 g/mol. Its IUPAC name is N-(5-acetamido-2-chlorophenyl)-3-(dimethylsulfamoyl)-4,5-dimethylbenzamide.
| Compound Name | N-(5-acetamido-2-chlorophenyl)-3-(dimethylsulfamoyl)-4,5-dimethylbenzamide |
|---|---|
| PubChem CID | 55917241 |
| Molecular Formula | C19H22ClN3O4S |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | N-(5-acetamido-2-chlorophenyl)-3-(dimethylsulfamoyl)-4,5-dimethylbenzamide |
| SMILES | CC(=O)Nc1ccc(Cl)c(NC(=O)c2cc(C)c(C)c(S(=O)(=O)N(C)C)c2)c1 |
| InChI | InChI=1S/C19H22ClN3O4S/c1-11-8-14(9-18(12(11)2)28(26,27)23(4)5)19(25)22-17-10-15(21-13(3)24)6-7-16(17)20/h6-10H,1-5H3,(H,21,24)(H,22,25) |
| InChIKey | HPSKIYDGVPPAPX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |