C19H20N2O3S — CID 51337793
3-(dimethylsulfamoyl)-N-(3-ethynylphenyl)-4,5-dimethylbenzamide (PubChem CID 51337793) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-(3-ethynylphenyl)-4,5-dimethylbenzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-(3-ethynylphenyl)-4,5-dimethylbenzamide |
|---|---|
| PubChem CID | 51337793 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-(3-ethynylphenyl)-4,5-dimethylbenzamide |
| SMILES | C#Cc1cccc(NC(=O)c2cc(C)c(C)c(S(=O)(=O)N(C)C)c2)c1 |
| InChI | InChI=1S/C19H20N2O3S/c1-6-15-8-7-9-17(11-15)20-19(22)16-10-13(2)14(3)18(12-16)25(23,24)21(4)5/h1,7-12H,2-5H3,(H,20,22) |
| InChIKey | LYWXTMBDBUAPKQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|