C18H20F2N2O4S — CID 34273541
N-[4-(difluoromethoxy)phenyl]-3-(dimethylsulfamoyl)-4,5-dimethylbenzamide (PubChem CID 34273541) has the molecular formula C18H20F2N2O4S and a molecular weight of 398.43 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-3-(dimethylsulfamoyl)-4,5-dimethylbenzamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-3-(dimethylsulfamoyl)-4,5-dimethylbenzamide |
|---|---|
| PubChem CID | 34273541 |
| Molecular Formula | C18H20F2N2O4S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-3-(dimethylsulfamoyl)-4,5-dimethylbenzamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(OC(F)F)cc2)cc(S(=O)(=O)N(C)C)c1C |
| InChI | InChI=1S/C18H20F2N2O4S/c1-11-9-13(10-16(12(11)2)27(24,25)22(3)4)17(23)21-14-5-7-15(8-6-14)26-18(19)20/h5-10,18H,1-4H3,(H,21,23) |
| InChIKey | DMVRLCLDYMHVPM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |