C16H18ClN3O3S — CID 34136281
N-(5-chloro-2-pyridinyl)-3-(dimethylsulfamoyl)-4,5-dimethylbenzamide (PubChem CID 34136281) has the molecular formula C16H18ClN3O3S and a molecular weight of 367.86 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-3-(dimethylsulfamoyl)-4,5-dimethylbenzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-3-(dimethylsulfamoyl)-4,5-dimethylbenzamide |
|---|---|
| PubChem CID | 34136281 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-3-(dimethylsulfamoyl)-4,5-dimethylbenzamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(Cl)cn2)cc(S(=O)(=O)N(C)C)c1C |
| InChI | InChI=1S/C16H18ClN3O3S/c1-10-7-12(8-14(11(10)2)24(22,23)20(3)4)16(21)19-15-6-5-13(17)9-18-15/h5-9H,1-4H3,(H,18,19,21) |
| InChIKey | BMEDPHFRHMKVKK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |