C14H12ClF2N3O — CID 63187369
N-(5-chloro-2-pyridinyl)-4-(ethylamino)-3,5-difluorobenzamide (PubChem CID 63187369) has the molecular formula C14H12ClF2N3O and a molecular weight of 311.72 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-4-(ethylamino)-3,5-difluorobenzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-4-(ethylamino)-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 63187369 |
| Molecular Formula | C14H12ClF2N3O |
| Molecular Weight | 311.72 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-4-(ethylamino)-3,5-difluorobenzamide |
| SMILES | CCNc1c(F)cc(C(=O)Nc2ccc(Cl)cn2)cc1F |
| InChI | InChI=1S/C14H12ClF2N3O/c1-2-18-13-10(16)5-8(6-11(13)17)14(21)20-12-4-3-9(15)7-19-12/h3-7,18H,2H2,1H3,(H,19,20,21) |
| InChIKey | JDAGYZUMXYCTSN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.72 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |