C18H10Cl4N4O2 — CID 3421055
4,5-dichloro-1-N,2-N-bis(5-chloro-2-pyridinyl)benzene-1,2-dicarboxamide (PubChem CID 3421055) has the molecular formula C18H10Cl4N4O2 and a molecular weight of 456.12 g/mol. Its IUPAC name is 4,5-dichloro-1-N,2-N-bis(5-chloro-2-pyridinyl)benzene-1,2-dicarboxamide.
| Compound Name | 4,5-dichloro-1-N,2-N-bis(5-chloro-2-pyridinyl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 3421055 |
| Molecular Formula | C18H10Cl4N4O2 |
| Molecular Weight | 456.12 g/mol |
| Exact Mass | 453.96 |
| IUPAC Name | 4,5-dichloro-1-N,2-N-bis(5-chloro-2-pyridinyl)benzene-1,2-dicarboxamide |
| SMILES | O=C(Nc1ccc(Cl)cn1)c1cc(Cl)c(Cl)cc1C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C18H10Cl4N4O2/c19-9-1-3-15(23-7-9)25-17(27)11-5-13(21)14(22)6-12(11)18(28)26-16-4-2-10(20)8-24-16/h1-8H,(H,23,25,27)(H,24,26,28) |
| InChIKey | QLABXHSINYWZTA-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.12 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |