C17H11Cl2N5O2 — CID 3421113
2-N,6-N-bis(5-chloro-2-pyridinyl)pyridine-2,6-dicarboxamide (PubChem CID 3421113) has the molecular formula C17H11Cl2N5O2 and a molecular weight of 388.21 g/mol. Its IUPAC name is 2-N,6-N-bis(5-chloro-2-pyridinyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(5-chloro-2-pyridinyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 3421113 |
| Molecular Formula | C17H11Cl2N5O2 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 2-N,6-N-bis(5-chloro-2-pyridinyl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccc(Cl)cn1)c1cccc(C(=O)Nc2ccc(Cl)cn2)n1 |
| InChI | InChI=1S/C17H11Cl2N5O2/c18-10-4-6-14(20-8-10)23-16(25)12-2-1-3-13(22-12)17(26)24-15-7-5-11(19)9-21-15/h1-9H,(H,20,23,25)(H,21,24,26) |
| InChIKey | RGVJJSSSMYPAHD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |