C13H11ClN2O2 — CID 28831587
N-(5-chloro-2-pyridinyl)-2-hydroxy-5-methylbenzamide (PubChem CID 28831587) has the molecular formula C13H11ClN2O2 and a molecular weight of 262.70 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-hydroxy-5-methylbenzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-hydroxy-5-methylbenzamide |
|---|---|
| PubChem CID | 28831587 |
| Molecular Formula | C13H11ClN2O2 |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-hydroxy-5-methylbenzamide |
| SMILES | Cc1ccc(O)c(C(=O)Nc2ccc(Cl)cn2)c1 |
| InChI | InChI=1S/C13H11ClN2O2/c1-8-2-4-11(17)10(6-8)13(18)16-12-5-3-9(14)7-15-12/h2-7,17H,1H3,(H,15,16,18) |
| InChIKey | HELIBWGDHFPXFL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |