C12H11F2N5O — CID 114389554
4-(ethylamino)-3,5-difluoro-N-(1,2,4-triazin-3-yl)benzamide (PubChem CID 114389554) has the molecular formula C12H11F2N5O and a molecular weight of 279.25 g/mol. Its IUPAC name is 4-(ethylamino)-3,5-difluoro-N-(1,2,4-triazin-3-yl)benzamide.
| Compound Name | 4-(ethylamino)-3,5-difluoro-N-(1,2,4-triazin-3-yl)benzamide |
|---|---|
| PubChem CID | 114389554 |
| Molecular Formula | C12H11F2N5O |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 4-(ethylamino)-3,5-difluoro-N-(1,2,4-triazin-3-yl)benzamide |
| SMILES | CCNc1c(F)cc(C(=O)Nc2nccnn2)cc1F |
| InChI | InChI=1S/C12H11F2N5O/c1-2-15-10-8(13)5-7(6-9(10)14)11(20)18-12-16-3-4-17-19-12/h3-6,15H,2H2,1H3,(H,16,18,19,20) |
| InChIKey | YRFAUUAOXYZJQK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |