C11H15F2N3O — CID 83025049
4-(ethylamino)-3,5-difluoro-N',N'-dimethylbenzohydrazide (PubChem CID 83025049) has the molecular formula C11H15F2N3O and a molecular weight of 243.26 g/mol. Its IUPAC name is 4-(ethylamino)-3,5-difluoro-N',N'-dimethylbenzohydrazide.
| Compound Name | 4-(ethylamino)-3,5-difluoro-N',N'-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 83025049 |
| Molecular Formula | C11H15F2N3O |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 4-(ethylamino)-3,5-difluoro-N',N'-dimethylbenzohydrazide |
| SMILES | CCNc1c(F)cc(C(=O)NN(C)C)cc1F |
| InChI | InChI=1S/C11H15F2N3O/c1-4-14-10-8(12)5-7(6-9(10)13)11(17)15-16(2)3/h5-6,14H,4H2,1-3H3,(H,15,17) |
| InChIKey | XEFXKOMAEAUJCG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|