C13H13F2N3O2 — CID 63183718
4-(ethylamino)-3,5-difluoro-N-(3-methyl-1,2-oxazol-5-yl)benzamide (PubChem CID 63183718) has the molecular formula C13H13F2N3O2 and a molecular weight of 281.26 g/mol. Its IUPAC name is 4-(ethylamino)-3,5-difluoro-N-(3-methyl-1,2-oxazol-5-yl)benzamide.
| Compound Name | 4-(ethylamino)-3,5-difluoro-N-(3-methyl-1,2-oxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 63183718 |
| Molecular Formula | C13H13F2N3O2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 4-(ethylamino)-3,5-difluoro-N-(3-methyl-1,2-oxazol-5-yl)benzamide |
| SMILES | CCNc1c(F)cc(C(=O)Nc2cc(C)no2)cc1F |
| InChI | InChI=1S/C13H13F2N3O2/c1-3-16-12-9(14)5-8(6-10(12)15)13(19)17-11-4-7(2)18-20-11/h4-6,16H,3H2,1-2H3,(H,17,19) |
| InChIKey | KETDFLHMVICBFG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |