C15H16F2N2OS — CID 63185485
4-(ethylamino)-3,5-difluoro-N-(1-thiophen-2-ylethyl)benzamide (PubChem CID 63185485) has the molecular formula C15H16F2N2OS and a molecular weight of 310.37 g/mol. Its IUPAC name is 4-(ethylamino)-3,5-difluoro-N-(1-thiophen-2-ylethyl)benzamide.
| Compound Name | 4-(ethylamino)-3,5-difluoro-N-(1-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 63185485 |
| Molecular Formula | C15H16F2N2OS |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-(ethylamino)-3,5-difluoro-N-(1-thiophen-2-ylethyl)benzamide |
| SMILES | CCNc1c(F)cc(C(=O)NC(C)c2cccs2)cc1F |
| InChI | InChI=1S/C15H16F2N2OS/c1-3-18-14-11(16)7-10(8-12(14)17)15(20)19-9(2)13-5-4-6-21-13/h4-9,18H,3H2,1-2H3,(H,19,20) |
| InChIKey | IHUWFOVWINZUKT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |