C13H13F2N3OS — CID 63186296
3,5-difluoro-4-hydrazinyl-N-(1-thiophen-2-ylethyl)benzamide (PubChem CID 63186296) has the molecular formula C13H13F2N3OS and a molecular weight of 297.33 g/mol. Its IUPAC name is 3,5-difluoro-4-hydrazinyl-N-(1-thiophen-2-ylethyl)benzamide.
| Compound Name | 3,5-difluoro-4-hydrazinyl-N-(1-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 63186296 |
| Molecular Formula | C13H13F2N3OS |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 3,5-difluoro-4-hydrazinyl-N-(1-thiophen-2-ylethyl)benzamide |
| SMILES | CC(NC(=O)c1cc(F)c(NN)c(F)c1)c1cccs1 |
| InChI | InChI=1S/C13H13F2N3OS/c1-7(11-3-2-4-20-11)17-13(19)8-5-9(14)12(18-16)10(15)6-8/h2-7,18H,16H2,1H3,(H,17,19) |
| InChIKey | LIIUPYHSVAPJNR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|